C25H16N4O4S — CID 135996901
N-(9,10-dioxoanthracen-2-yl)-2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide (PubChem CID 135996901) has the molecular formula C25H16N4O4S and a molecular weight of 468.49 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135996901 |
| Molecular Formula | C25H16N4O4S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)c(=O)[nH]1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H16N4O4S/c30-20(13-34-25-27-24(33)21(28-29-25)14-6-2-1-3-7-14)26-15-10-11-18-19(12-15)23(32)17-9-5-4-8-16(17)22(18)31/h1-12H,13H2,(H,26,30)(H,27,29,33) |
| InChIKey | HHRYJXOSBWDRBV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|