C19H19N5O4S — CID 135540707
2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide (PubChem CID 135540707) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135540707 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CSc2nnc(-c3ccccc3N)c(=O)[nH]2)cc(OC)c1 |
| InChI | InChI=1S/C19H19N5O4S/c1-27-12-7-11(8-13(9-12)28-2)21-16(25)10-29-19-22-18(26)17(23-24-19)14-5-3-4-6-15(14)20/h3-9H,10,20H2,1-2H3,(H,21,25)(H,22,24,26) |
| InChIKey | LUSQFZJQZNFWIZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|