C19H18ClN5O2S — CID 135690597
2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(1S)-1-(3-chlorophenyl)ethyl]acetamide (PubChem CID 135690597) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(1S)-1-(3-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(1S)-1-(3-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 135690597 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(1S)-1-(3-chlorophenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CSc1nnc(-c2ccccc2N)c(=O)[nH]1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18ClN5O2S/c1-11(12-5-4-6-13(20)9-12)22-16(26)10-28-19-23-18(27)17(24-25-19)14-7-2-3-8-15(14)21/h2-9,11H,10,21H2,1H3,(H,22,26)(H,23,25,27)/t11-/m0/s1 |
| InChIKey | UOXFALXPMCWANQ-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|