C18H15FN6O3S — CID 135690600
2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(2-fluorophenyl)carbamoyl]acetamide (PubChem CID 135690600) has the molecular formula C18H15FN6O3S and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(2-fluorophenyl)carbamoyl]acetamide.
| Compound Name | 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(2-fluorophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 135690600 |
| Molecular Formula | C18H15FN6O3S |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[[6-(2-aminophenyl)-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-N-[(2-fluorophenyl)carbamoyl]acetamide |
| SMILES | Nc1ccccc1-c1nnc(SCC(=O)NC(=O)Nc2ccccc2F)[nH]c1=O |
| InChI | InChI=1S/C18H15FN6O3S/c19-11-6-2-4-8-13(11)21-17(28)22-14(26)9-29-18-23-16(27)15(24-25-18)10-5-1-3-7-12(10)20/h1-8H,9,20H2,(H,23,25,27)(H2,21,22,26,28) |
| InChIKey | ADSUAVAHGYBWDZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|