C18H20ClFN2OS — CID 119340498
2-amino-N-[[4-(4-chlorophenyl)-2-fluorophenyl]methyl]-4-methylsulfanylbutanamide (PubChem CID 119340498) has the molecular formula C18H20ClFN2OS and a molecular weight of 366.89 g/mol. Its IUPAC name is 2-amino-N-[[4-(4-chlorophenyl)-2-fluorophenyl]methyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-amino-N-[[4-(4-chlorophenyl)-2-fluorophenyl]methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119340498 |
| Molecular Formula | C18H20ClFN2OS |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-amino-N-[[4-(4-chlorophenyl)-2-fluorophenyl]methyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(N)C(=O)NCc1ccc(-c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C18H20ClFN2OS/c1-24-9-8-17(21)18(23)22-11-14-3-2-13(10-16(14)20)12-4-6-15(19)7-5-12/h2-7,10,17H,8-9,11,21H2,1H3,(H,22,23) |
| InChIKey | CSKLBOIWMPJWPC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |