C14H21FN2O2S — CID 119320067
(2S)-2-amino-N-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-4-methylsulfanylbutanamide (PubChem CID 119320067) has the molecular formula C14H21FN2O2S and a molecular weight of 300.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119320067 |
| Molecular Formula | C14H21FN2O2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2S)-2-amino-N-[[4-fluoro-3-(methoxymethyl)phenyl]methyl]-4-methylsulfanylbutanamide |
| SMILES | COCc1cc(CNC(=O)[C@@H](N)CCSC)ccc1F |
| InChI | InChI=1S/C14H21FN2O2S/c1-19-9-11-7-10(3-4-12(11)15)8-17-14(18)13(16)5-6-20-2/h3-4,7,13H,5-6,8-9,16H2,1-2H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | KLHCUQKRQTZBAY-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |