C12H20F3NO2 — CID 131949460
N-(3-cyclopentyloxypropyl)-4,4,4-trifluorobutanamide (PubChem CID 131949460) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 131949460 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NCCCOC1CCCC1 |
| InChI | InChI=1S/C12H20F3NO2/c13-12(14,15)7-6-11(17)16-8-3-9-18-10-4-1-2-5-10/h10H,1-9H2,(H,16,17) |
| InChIKey | ZKYLWXHEUAFSIM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|