C15H30N2O2 — CID 65291239
6-amino-N-(2-cyclopentyloxyethyl)-4,4-dimethylhexanamide (PubChem CID 65291239) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 6-amino-N-(2-cyclopentyloxyethyl)-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-(2-cyclopentyloxyethyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65291239 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 6-amino-N-(2-cyclopentyloxyethyl)-4,4-dimethylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)NCCOC1CCCC1 |
| InChI | InChI=1S/C15H30N2O2/c1-15(2,9-10-16)8-7-14(18)17-11-12-19-13-5-3-4-6-13/h13H,3-12,16H2,1-2H3,(H,17,18) |
| InChIKey | MDVPDSJUIGCCMY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|