C13H24ClF3N2O — CID 119621375
N-[2-(cycloheptylamino)ethyl]-4,4,4-trifluorobutanamide;hydrochloride (PubChem CID 119621375) has the molecular formula C13H24ClF3N2O and a molecular weight of 316.80 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-4,4,4-trifluorobutanamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-4,4,4-trifluorobutanamide;hydrochloride |
|---|---|
| PubChem CID | 119621375 |
| Molecular Formula | C13H24ClF3N2O |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-4,4,4-trifluorobutanamide;hydrochloride |
| SMILES | Cl.O=C(CCC(F)(F)F)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C13H23F3N2O.ClH/c14-13(15,16)8-7-12(19)18-10-9-17-11-5-3-1-2-4-6-11;/h11,17H,1-10H2,(H,18,19);1H |
| InChIKey | YSMSQYORQWLDFT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|