C14H28ClN3O2 — CID 119620746
2-[acetyl(methyl)amino]-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride (PubChem CID 119620746) has the molecular formula C14H28ClN3O2 and a molecular weight of 305.85 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-[acetyl(methyl)amino]-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119620746 |
| Molecular Formula | C14H28ClN3O2 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-[acetyl(methyl)amino]-N-[2-(cycloheptylamino)ethyl]acetamide;hydrochloride |
| SMILES | CC(=O)N(C)CC(=O)NCCNC1CCCCCC1.Cl |
| InChI | InChI=1S/C14H27N3O2.ClH/c1-12(18)17(2)11-14(19)16-10-9-15-13-7-5-3-4-6-8-13;/h13,15H,3-11H2,1-2H3,(H,16,19);1H |
| InChIKey | FMJDVTBAXIMJGN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|