C17H22Cl2N2O3 — CID 108972921
1-N'-[2-(2,4-dichlorophenyl)ethyl]-1-N-(3-methoxypropyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108972921) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 1-N'-[2-(2,4-dichlorophenyl)ethyl]-1-N-(3-methoxypropyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-(2,4-dichlorophenyl)ethyl]-1-N-(3-methoxypropyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108972921 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-N'-[2-(2,4-dichlorophenyl)ethyl]-1-N-(3-methoxypropyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COCCCNC(=O)C1(C(=O)NCCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-24-10-2-8-20-15(22)17(6-7-17)16(23)21-9-5-12-3-4-13(18)11-14(12)19/h3-4,11H,2,5-10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | INBRDVRGXZGSBA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|