C13H17Cl2NO4 — CID 103877357
2-(2,4-dichlorophenoxy)-N-(3-hydroxy-4-methoxybutyl)acetamide (PubChem CID 103877357) has the molecular formula C13H17Cl2NO4 and a molecular weight of 322.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(3-hydroxy-4-methoxybutyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(3-hydroxy-4-methoxybutyl)acetamide |
|---|---|
| PubChem CID | 103877357 |
| Molecular Formula | C13H17Cl2NO4 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(3-hydroxy-4-methoxybutyl)acetamide |
| SMILES | COCC(O)CCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO4/c1-19-7-10(17)4-5-16-13(18)8-20-12-3-2-9(14)6-11(12)15/h2-3,6,10,17H,4-5,7-8H2,1H3,(H,16,18) |
| InChIKey | XVBOXFUTEXUPSV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |