C15H23NO5 — CID 103876701
N-(3-hydroxy-4-methoxybutyl)-2-(2-methoxy-4-methylphenoxy)acetamide (PubChem CID 103876701) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-(3-hydroxy-4-methoxybutyl)-2-(2-methoxy-4-methylphenoxy)acetamide.
| Compound Name | N-(3-hydroxy-4-methoxybutyl)-2-(2-methoxy-4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 103876701 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-(3-hydroxy-4-methoxybutyl)-2-(2-methoxy-4-methylphenoxy)acetamide |
| SMILES | COCC(O)CCNC(=O)COc1ccc(C)cc1OC |
| InChI | InChI=1S/C15H23NO5/c1-11-4-5-13(14(8-11)20-3)21-10-15(18)16-7-6-12(17)9-19-2/h4-5,8,12,17H,6-7,9-10H2,1-3H3,(H,16,18) |
| InChIKey | NOXZAXZFZMNVHX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |