C14H21NO5 — CID 60728745
2-[4-(1-hydroxyethyl)-2-methoxyphenoxy]-N-(2-methoxyethyl)acetamide (PubChem CID 60728745) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[4-(1-hydroxyethyl)-2-methoxyphenoxy]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-(1-hydroxyethyl)-2-methoxyphenoxy]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 60728745 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[4-(1-hydroxyethyl)-2-methoxyphenoxy]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1ccc(C(C)O)cc1OC |
| InChI | InChI=1S/C14H21NO5/c1-10(16)11-4-5-12(13(8-11)19-3)20-9-14(17)15-6-7-18-2/h4-5,8,10,16H,6-7,9H2,1-3H3,(H,15,17) |
| InChIKey | QRKHVGIQGSCLBV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|