C13H18ClNO4 — CID 78931610
2-[4-chloro-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methoxyethyl)acetamide (PubChem CID 78931610) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-[4-chloro-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 78931610 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[4-chloro-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1ccc(Cl)cc1[C@H](C)O |
| InChI | InChI=1S/C13H18ClNO4/c1-9(16)11-7-10(14)3-4-12(11)19-8-13(17)15-5-6-18-2/h3-4,7,9,16H,5-6,8H2,1-2H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | NKIGIVZUHSFRPH-VIFPVBQESA-N |
| XLogP | 1.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|