C14H19NO4 — CID 78931618
N-cyclopropyl-2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]acetamide (PubChem CID 78931618) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 78931618 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-cyclopropyl-2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc([C@H](C)O)ccc1OCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H19NO4/c1-9(16)10-3-6-12(13(7-10)18-2)19-8-14(17)15-11-4-5-11/h3,6-7,9,11,16H,4-5,8H2,1-2H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | GXDOLKGZAXWPJA-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |