C12H16N2O4 — CID 60666680
2-[[2-(2-methoxy-4-methylphenoxy)acetyl]amino]acetamide (PubChem CID 60666680) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[[2-(2-methoxy-4-methylphenoxy)acetyl]amino]acetamide.
| Compound Name | 2-[[2-(2-methoxy-4-methylphenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 60666680 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-[[2-(2-methoxy-4-methylphenoxy)acetyl]amino]acetamide |
| SMILES | COc1cc(C)ccc1OCC(=O)NCC(N)=O |
| InChI | InChI=1S/C12H16N2O4/c1-8-3-4-9(10(5-8)17-2)18-7-12(16)14-6-11(13)15/h3-5H,6-7H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | IYFJIOZSAQVNHJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |