C24H33N3O5S2 — CID 17112963
N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-4-(2-ethoxyethoxy)benzamide (PubChem CID 17112963) has the molecular formula C24H33N3O5S2 and a molecular weight of 507.68 g/mol. Its IUPAC name is N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-4-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-4-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17112963 |
| Molecular Formula | C24H33N3O5S2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-4-(2-ethoxyethoxy)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc(OCCOCC)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O5S2/c1-4-15-27(16-5-2)34(29,30)22-13-9-20(10-14-22)25-24(33)26-23(28)19-7-11-21(12-8-19)32-18-17-31-6-3/h7-14H,4-6,15-18H2,1-3H3,(H2,25,26,28,33) |
| InChIKey | HKCPTELQLOBMEO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|