C17H17F2NO5S — CID 9072147
4-(difluoromethoxy)-3-ethoxy-N-(3-methylsulfonylphenyl)benzamide (PubChem CID 9072147) has the molecular formula C17H17F2NO5S and a molecular weight of 385.39 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-ethoxy-N-(3-methylsulfonylphenyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-3-ethoxy-N-(3-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 9072147 |
| Molecular Formula | C17H17F2NO5S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-(difluoromethoxy)-3-ethoxy-N-(3-methylsulfonylphenyl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc(S(C)(=O)=O)c2)ccc1OC(F)F |
| InChI | InChI=1S/C17H17F2NO5S/c1-3-24-15-9-11(7-8-14(15)25-17(18)19)16(21)20-12-5-4-6-13(10-12)26(2,22)23/h4-10,17H,3H2,1-2H3,(H,20,21) |
| InChIKey | JQQXYAZOVQPKST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |