C24H19BrN2O2 — CID 126187586
N-(5-bromoquinolin-8-yl)-4-[(4-methylphenoxy)methyl]benzamide (PubChem CID 126187586) has the molecular formula C24H19BrN2O2 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-(5-bromoquinolin-8-yl)-4-[(4-methylphenoxy)methyl]benzamide.
| Compound Name | N-(5-bromoquinolin-8-yl)-4-[(4-methylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 126187586 |
| Molecular Formula | C24H19BrN2O2 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | N-(5-bromoquinolin-8-yl)-4-[(4-methylphenoxy)methyl]benzamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)Nc3ccc(Br)c4cccnc34)cc2)cc1 |
| InChI | InChI=1S/C24H19BrN2O2/c1-16-4-10-19(11-5-16)29-15-17-6-8-18(9-7-17)24(28)27-22-13-12-21(25)20-3-2-14-26-23(20)22/h2-14H,15H2,1H3,(H,27,28) |
| InChIKey | BBNAYWILQZKZEG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |