C31H25F4N3O3 — CID 19286546
5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]furan-2-carboxamide (PubChem CID 19286546) has the molecular formula C31H25F4N3O3 and a molecular weight of 563.55 g/mol. Its IUPAC name is 5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]furan-2-carboxamide.
| Compound Name | 5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19286546 |
| Molecular Formula | C31H25F4N3O3 |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]furan-2-carboxamide |
| SMILES | CC(C)(c1ccccc1)c1ccc(OCc2ccc(C(=O)Nc3ccn(Cc4c(F)c(F)cc(F)c4F)n3)o2)cc1 |
| InChI | InChI=1S/C31H25F4N3O3/c1-31(2,19-6-4-3-5-7-19)20-8-10-21(11-9-20)40-18-22-12-13-26(41-22)30(39)36-27-14-15-38(37-27)17-23-28(34)24(32)16-25(33)29(23)35/h3-16H,17-18H2,1-2H3,(H,36,37,39) |
| InChIKey | JFQMNJSNYOJQRC-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|