C16H17FN2O4 — CID 121255246
methyl 5-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]pentanoate (PubChem CID 121255246) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is methyl 5-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]pentanoate.
| Compound Name | methyl 5-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 121255246 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | methyl 5-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C16H17FN2O4/c1-22-15(20)4-2-3-9-18-16(21)13-10-14(23-19-13)11-5-7-12(17)8-6-11/h5-8,10H,2-4,9H2,1H3,(H,18,21) |
| InChIKey | QKZCWBPMEJOHJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|