C19H25FN4O2S — CID 142434206
5-(4-fluorophenyl)-N-[5-[3-(methylsulfanylamino)azetidin-1-yl]pentyl]-1,2-oxazole-3-carboxamide (PubChem CID 142434206) has the molecular formula C19H25FN4O2S and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[5-[3-(methylsulfanylamino)azetidin-1-yl]pentyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[5-[3-(methylsulfanylamino)azetidin-1-yl]pentyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 142434206 |
| Molecular Formula | C19H25FN4O2S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[5-[3-(methylsulfanylamino)azetidin-1-yl]pentyl]-1,2-oxazole-3-carboxamide |
| SMILES | CSNC1CN(CCCCCNC(=O)c2cc(-c3ccc(F)cc3)on2)C1 |
| InChI | InChI=1S/C19H25FN4O2S/c1-27-23-16-12-24(13-16)10-4-2-3-9-21-19(25)17-11-18(26-22-17)14-5-7-15(20)8-6-14/h5-8,11,16,23H,2-4,9-10,12-13H2,1H3,(H,21,25) |
| InChIKey | UUGVGDATLIVDQJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|