C13H13N5O3 — CID 25164314
5-(furan-3-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide (PubChem CID 25164314) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 5-(furan-3-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-3-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 25164314 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-(furan-3-yl)-N-[3-(1,2,4-triazol-1-yl)propyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCn1cncn1)c1cc(-c2ccoc2)on1 |
| InChI | InChI=1S/C13H13N5O3/c19-13(15-3-1-4-18-9-14-8-16-18)11-6-12(21-17-11)10-2-5-20-7-10/h2,5-9H,1,3-4H2,(H,15,19) |
| InChIKey | MDYKBBNVMONHPZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|