C19H19N5O4S — CID 131990251
methyl 6-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propylcarbamoyl]pyridine-3-carboxylate (PubChem CID 131990251) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is methyl 6-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propylcarbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propylcarbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 131990251 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 6-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propylcarbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCCCNC(=O)c2cc(-c3cccs3)[nH]n2)nc1 |
| InChI | InChI=1S/C19H19N5O4S/c1-28-19(27)12-5-6-13(22-11-12)17(25)20-7-3-8-21-18(26)15-10-14(23-24-15)16-4-2-9-29-16/h2,4-6,9-11H,3,7-8H2,1H3,(H,20,25)(H,21,26)(H,23,24) |
| InChIKey | BMGVLKNBSGPYNR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|