C18H19N5O3S — CID 131990240
4-methyl-2-oxo-N-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide (PubChem CID 131990240) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide.
| Compound Name | 4-methyl-2-oxo-N-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 131990240 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-methyl-2-oxo-N-[3-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]propyl]-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc[nH]c(=O)c1C(=O)NCCCNC(=O)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C18H19N5O3S/c1-11-5-8-21-18(26)15(11)17(25)20-7-3-6-19-16(24)13-10-12(22-23-13)14-4-2-9-27-14/h2,4-5,8-10H,3,6-7H2,1H3,(H,19,24)(H,20,25)(H,21,26)(H,22,23) |
| InChIKey | UOEXQTWZUCROKO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|