C12H17ClN4OS — CID 119494825
N-(3-aminobutyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119494825) has the molecular formula C12H17ClN4OS and a molecular weight of 300.81 g/mol. Its IUPAC name is N-(3-aminobutyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119494825 |
| Molecular Formula | C12H17ClN4OS |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-(3-aminobutyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1cc(-c2cccs2)[nH]n1.Cl |
| InChI | InChI=1S/C12H16N4OS.ClH/c1-8(13)4-5-14-12(17)10-7-9(15-16-10)11-3-2-6-18-11;/h2-3,6-8H,4-5,13H2,1H3,(H,14,17)(H,15,16);1H |
| InChIKey | WHZFFUVYGNDIPB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |