C12H15N3O3S — CID 91895150
N-(2,2-dimethoxyethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 91895150) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91895150 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | COC(CNC(=O)c1cc(-c2cccs2)[nH]n1)OC |
| InChI | InChI=1S/C12H15N3O3S/c1-17-11(18-2)7-13-12(16)9-6-8(14-15-9)10-4-3-5-19-10/h3-6,11H,7H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | VUAKWAGNIVMITD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|