C23H27BrF3N3O2 — CID 90853118
N-[4-[4-[4-bromo-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-methoxybenzamide (PubChem CID 90853118) has the molecular formula C23H27BrF3N3O2 and a molecular weight of 514.39 g/mol. Its IUPAC name is N-[4-[4-[4-bromo-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-methoxybenzamide.
| Compound Name | N-[4-[4-[4-bromo-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 90853118 |
| Molecular Formula | C23H27BrF3N3O2 |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | N-[4-[4-[4-bromo-3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCN2CCN(c3ccc(Br)c(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H27BrF3N3O2/c1-32-19-7-4-17(5-8-19)22(31)28-10-2-3-11-29-12-14-30(15-13-29)18-6-9-21(24)20(16-18)23(25,26)27/h4-9,16H,2-3,10-15H2,1H3,(H,28,31) |
| InChIKey | MUBMSOCGJGZFHN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|