C19H20N2O6S — CID 56561819
N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56561819) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56561819 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-ethyl-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C19H20N2O6S/c1-4-21(11-12-5-8-16(26-2)17(9-12)27-3)28(24,25)13-6-7-14-15(10-13)19(23)20-18(14)22/h5-10H,4,11H2,1-3H3,(H,20,22,23) |
| InChIKey | INDLROCBFUQWOM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|