C13H17Cl3N2O — CID 119444290
2,4-dichloro-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 119444290) has the molecular formula C13H17Cl3N2O and a molecular weight of 323.65 g/mol. Its IUPAC name is 2,4-dichloro-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride.
| Compound Name | 2,4-dichloro-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119444290 |
| Molecular Formula | C13H17Cl3N2O |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2,4-dichloro-N-methyl-N-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | CN(C(=O)c1ccc(Cl)cc1Cl)C1CCNCC1.Cl |
| InChI | InChI=1S/C13H16Cl2N2O.ClH/c1-17(10-4-6-16-7-5-10)13(18)11-3-2-9(14)8-12(11)15;/h2-3,8,10,16H,4-7H2,1H3;1H |
| InChIKey | MGINURDUEKNUSP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |