C13H15F3N2O — CID 79750025
2,3,4-trifluoro-N-methyl-N-piperidin-4-ylbenzamide (PubChem CID 79750025) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-methyl-N-piperidin-4-ylbenzamide.
| Compound Name | 2,3,4-trifluoro-N-methyl-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 79750025 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2,3,4-trifluoro-N-methyl-N-piperidin-4-ylbenzamide |
| SMILES | CN(C(=O)c1ccc(F)c(F)c1F)C1CCNCC1 |
| InChI | InChI=1S/C13H15F3N2O/c1-18(8-4-6-17-7-5-8)13(19)9-2-3-10(14)12(16)11(9)15/h2-3,8,17H,4-7H2,1H3 |
| InChIKey | BBBZYPJMAHFMGW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|