C22H26BNO4 — CID 164603208
N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 164603208) has the molecular formula C22H26BNO4 and a molecular weight of 379.27 g/mol. Its IUPAC name is N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 164603208 |
| Molecular Formula | C22H26BNO4 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(C(=O)N[C@@H]3c4ccccc4C[C@@H]3O)cc2)OC1(C)C |
| InChI | InChI=1S/C22H26BNO4/c1-21(2)22(3,4)28-23(27-21)16-11-9-14(10-12-16)20(26)24-19-17-8-6-5-7-15(17)13-18(19)25/h5-12,18-19,25H,13H2,1-4H3,(H,24,26)/t18-,19+/m0/s1 |
| InChIKey | ZIJXRTLFELCICC-RBUKOAKNSA-N |
| XLogP | 2.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|