C33H43N7O7 — CID 70324669
1-[5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl 5-(dihydroxyamino)oxypentyl carbonate (PubChem CID 70324669) has the molecular formula C33H43N7O7 and a molecular weight of 649.75 g/mol. Its IUPAC name is 1-[5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl 5-(dihydroxyamino)oxypentyl carbonate.
| Compound Name | 1-[5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl 5-(dihydroxyamino)oxypentyl carbonate |
|---|---|
| PubChem CID | 70324669 |
| Molecular Formula | C33H43N7O7 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | 1-[5-[2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]phenyl]phenyl]tetrazol-2-yl]ethyl 5-(dihydroxyamino)oxypentyl carbonate |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2-c2nnn(C(C)OC(=O)OCCCCCON(O)O)n2)cc1 |
| InChI | InChI=1S/C33H43N7O7/c1-3-4-14-29-34-33(19-8-9-20-33)31(41)38(29)23-25-15-17-26(18-16-25)27-12-6-7-13-28(27)30-35-37-39(36-30)24(2)47-32(42)45-21-10-5-11-22-46-40(43)44/h6-7,12-13,15-18,24,43-44H,3-5,8-11,14,19-23H2,1-2H3 |
| InChIKey | QKUMNMOAPZJFLZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 164.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|