C31H37ClN8O10 — CID 143701474
[1-(5,6-dinitrooxyhexoxy)-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 143701474) has the molecular formula C31H37ClN8O10 and a molecular weight of 717.14 g/mol. Its IUPAC name is [1-(5,6-dinitrooxyhexoxy)-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | [1-(5,6-dinitrooxyhexoxy)-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 143701474 |
| Molecular Formula | C31H37ClN8O10 |
| Molecular Weight | 717.14 g/mol |
| Exact Mass | 716.23 |
| IUPAC Name | [1-(5,6-dinitrooxyhexoxy)-1-oxopropan-2-yl] 2-butyl-5-chloro-3-[[4-[2-(N-hydrazinylidenecarbamimidoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | [H]/N=C(\N=N\N)c1ccccc1-c1ccc(Cn2c(CCCC)nc(Cl)c2C(=O)OC(C)C(=O)OCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H37ClN8O10/c1-3-4-12-26-35-28(32)27(31(42)49-20(2)30(41)47-17-8-7-9-23(50-40(45)46)19-48-39(43)44)38(26)18-21-13-15-22(16-14-21)24-10-5-6-11-25(24)29(33)36-37-34/h5-6,10-11,13-16,20,23H,3-4,7-9,12,17-19H2,1-2H3,(H3,33,34,36) |
| InChIKey | ACQLBHOHQIJTLL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 249.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.14 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|