C50H50ClN7O8 — CID 87526571
1-[(5R)-5-nitrooxyhexoxy]carbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate (PubChem CID 87526571) has the molecular formula C50H50ClN7O8 and a molecular weight of 912.44 g/mol. Its IUPAC name is 1-[(5R)-5-nitrooxyhexoxy]carbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 1-[(5R)-5-nitrooxyhexoxy]carbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 87526571 |
| Molecular Formula | C50H50ClN7O8 |
| Molecular Weight | 912.44 g/mol |
| Exact Mass | 911.34 |
| IUPAC Name | 1-[(5R)-5-nitrooxyhexoxy]carbonyloxyethyl 2-butyl-5-chloro-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OC(C)OC(=O)OCCCC[C@@H](C)O[N+](=O)[O-])n1Cc1ccc(-c2ccccc2)c(-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C50H50ClN7O8/c1-4-5-29-44-52-46(51)45(48(59)64-36(3)65-49(60)63-32-19-18-20-35(2)66-58(61)62)56(44)34-37-30-31-42(38-21-10-6-11-22-38)43(33-37)47-53-54-55-57(47)50(39-23-12-7-13-24-39,40-25-14-8-15-26-40)41-27-16-9-17-28-41/h6-17,21-28,30-31,33,35-36H,4-5,18-20,29,32,34H2,1-3H3/t35-,36?/m1/s1 |
| InChIKey | CIUWEFJDMAADHR-RERZGLEZSA-N |
| XLogP | 10.51 |
| TPSA | 175.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.44 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|