C50H51ClN7O8+ — CID 87526573
ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate (PubChem CID 87526573) has the molecular formula C50H51ClN7O8+ and a molecular weight of 913.45 g/mol. Its IUPAC name is ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate.
| Compound Name | ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 87526573 |
| Molecular Formula | C50H51ClN7O8+ |
| Molecular Weight | 913.45 g/mol |
| Exact Mass | 912.35 |
| IUPAC Name | ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate |
| SMILES | CCCCC1=NC(Cl)=C(C(=O)OCC)[N+]1(Cc1ccc(-c2ccccc2)c(-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1)OC(=O)OCCCC[C@@H](C)O[N+](=O)[O-] |
| InChI | InChI=1S/C50H51ClN7O8/c1-4-6-30-44-52-46(51)45(48(59)63-5-2)58(44,66-49(60)64-33-20-19-21-36(3)65-57(61)62)35-37-31-32-42(38-22-11-7-12-23-38)43(34-37)47-53-54-55-56(47)50(39-24-13-8-14-25-39,40-26-15-9-16-27-40)41-28-17-10-18-29-41/h7-18,22-29,31-32,34,36H,4-6,19-21,30,33,35H2,1-3H3/q+1/t36-,58?/m1/s1 |
| InChIKey | DUVTWRMVONVJBY-RFENVARKSA-N |
| XLogP | 10.57 |
| TPSA | 170.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.45 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|