C31H37ClN7O8+ — CID 87526706
ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate (PubChem CID 87526706) has the molecular formula C31H37ClN7O8+ and a molecular weight of 671.13 g/mol. Its IUPAC name is ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate.
| Compound Name | ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 87526706 |
| Molecular Formula | C31H37ClN7O8+ |
| Molecular Weight | 671.13 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | ethyl 2-butyl-5-chloro-3-[(5R)-5-nitrooxyhexoxy]carbonyloxy-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-3-ium-4-carboxylate |
| SMILES | CCCCC1=NC(Cl)=C(C(=O)OCC)[N+]1(Cc1ccc(-c2ccccc2)c(-c2nn[nH]n2)c1)OC(=O)OCCCC[C@@H](C)O[N+](=O)[O-] |
| InChI | InChI=1S/C31H37ClN7O8/c1-4-6-15-26-33-28(32)27(30(40)44-5-2)39(26,47-31(41)45-18-11-10-12-21(3)46-38(42)43)20-22-16-17-24(23-13-8-7-9-14-23)25(19-22)29-34-36-37-35-29/h7-9,13-14,16-17,19,21H,4-6,10-12,15,18,20H2,1-3H3,(H,34,35,36,37)/q+1/t21-,39?/m1/s1 |
| InChIKey | YULBAQHODOPDDI-KIQDXCFYSA-N |
| XLogP | 6.26 |
| TPSA | 181.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.13 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|