C33H39N7O6 — CID 69130834
1-ethoxycarbonyloxyethyl 2-butyl-5-[methyl(3-methylbut-2-enoyl)amino]-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate (PubChem CID 69130834) has the molecular formula C33H39N7O6 and a molecular weight of 629.72 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 2-butyl-5-[methyl(3-methylbut-2-enoyl)amino]-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl 2-butyl-5-[methyl(3-methylbut-2-enoyl)amino]-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 69130834 |
| Molecular Formula | C33H39N7O6 |
| Molecular Weight | 629.72 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 2-butyl-5-[methyl(3-methylbut-2-enoyl)amino]-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(N(C)C(=O)C=C(C)C)c(C(=O)OC(C)OC(=O)OCC)n1Cc1ccc(-c2ccccc2)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C33H39N7O6/c1-7-9-15-27-34-31(39(6)28(41)18-21(3)4)29(32(42)45-22(5)46-33(43)44-8-2)40(27)20-23-16-17-25(24-13-11-10-12-14-24)26(19-23)30-35-37-38-36-30/h10-14,16-19,22H,7-9,15,20H2,1-6H3,(H,35,36,37,38) |
| InChIKey | GNTGNNBYYPTBMH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|