C31H32ClN7O4 — CID 67694805
[2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-4-yl]-[5-(dimethoxymethyl)-6-methyl-1-oxidopyridin-1-ium-2-yl]methanone (PubChem CID 67694805) has the molecular formula C31H32ClN7O4 and a molecular weight of 602.10 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-4-yl]-[5-(dimethoxymethyl)-6-methyl-1-oxidopyridin-1-ium-2-yl]methanone.
| Compound Name | [2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-4-yl]-[5-(dimethoxymethyl)-6-methyl-1-oxidopyridin-1-ium-2-yl]methanone |
|---|---|
| PubChem CID | 67694805 |
| Molecular Formula | C31H32ClN7O4 |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-4-yl]-[5-(dimethoxymethyl)-6-methyl-1-oxidopyridin-1-ium-2-yl]methanone |
| SMILES | CCCCc1nc(Cl)c(C(=O)c2ccc(C(OC)OC)c(C)[n+]2[O-])n1Cc1ccc(-c2ccccc2)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C31H32ClN7O4/c1-5-6-12-26-33-29(32)27(28(40)25-16-15-22(19(2)39(25)41)31(42-3)43-4)38(26)18-20-13-14-23(21-10-8-7-9-11-21)24(17-20)30-34-36-37-35-30/h7-11,13-17,31H,5-6,12,18H2,1-4H3,(H,34,35,36,37) |
| InChIKey | SXHYKXKXVUGCJB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|