C28H26ClN7O3 — CID 57378338
[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(hydroxymethyl)-1-oxidopyridin-1-ium-2-yl]methanone (PubChem CID 57378338) has the molecular formula C28H26ClN7O3 and a molecular weight of 544.02 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(hydroxymethyl)-1-oxidopyridin-1-ium-2-yl]methanone.
| Compound Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(hydroxymethyl)-1-oxidopyridin-1-ium-2-yl]methanone |
|---|---|
| PubChem CID | 57378338 |
| Molecular Formula | C28H26ClN7O3 |
| Molecular Weight | 544.02 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(hydroxymethyl)-1-oxidopyridin-1-ium-2-yl]methanone |
| SMILES | CCCCc1nc(Cl)c(C(=O)c2ccc(CO)c[n+]2[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H26ClN7O3/c1-2-3-8-24-30-27(29)25(26(38)23-14-11-19(17-37)16-36(23)39)35(24)15-18-9-12-20(13-10-18)21-6-4-5-7-22(21)28-31-33-34-32-28/h4-7,9-14,16,37H,2-3,8,15,17H2,1H3,(H,31,32,33,34) |
| InChIKey | SHFHECIIQSTZQK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.02 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|