C28H28ClN7O2 — CID 57378664
[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-(5-methyl-1-oxidopyridin-1-ium-2-yl)methanol (PubChem CID 57378664) has the molecular formula C28H28ClN7O2 and a molecular weight of 530.03 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-(5-methyl-1-oxidopyridin-1-ium-2-yl)methanol.
| Compound Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-(5-methyl-1-oxidopyridin-1-ium-2-yl)methanol |
|---|---|
| PubChem CID | 57378664 |
| Molecular Formula | C28H28ClN7O2 |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-(5-methyl-1-oxidopyridin-1-ium-2-yl)methanol |
| SMILES | CCCCc1nc(Cl)c(C(O)c2ccc(C)c[n+]2[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H28ClN7O2/c1-3-4-9-24-30-27(29)25(26(37)23-15-10-18(2)16-36(23)38)35(24)17-19-11-13-20(14-12-19)21-7-5-6-8-22(21)28-31-33-34-32-28/h5-8,10-16,26,37H,3-4,9,17H2,1-2H3,(H,31,32,33,34) |
| InChIKey | CBDUWIAHRYTBPD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|