C31H30N8O — CID 21472362
2-butyl-5-methyl-6-(4-methyl-1-oxidopyridin-1-ium-2-yl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine (PubChem CID 21472362) has the molecular formula C31H30N8O and a molecular weight of 530.64 g/mol. Its IUPAC name is 2-butyl-5-methyl-6-(4-methyl-1-oxidopyridin-1-ium-2-yl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-butyl-5-methyl-6-(4-methyl-1-oxidopyridin-1-ium-2-yl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 21472362 |
| Molecular Formula | C31H30N8O |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-butyl-5-methyl-6-(4-methyl-1-oxidopyridin-1-ium-2-yl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCCCc1nc2cc(-c3cc(C)cc[n+]3[O-])c(C)nc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H30N8O/c1-4-5-10-29-33-27-18-26(28-17-20(2)15-16-39(28)40)21(3)32-31(27)38(29)19-22-11-13-23(14-12-22)24-8-6-7-9-25(24)30-34-36-37-35-30/h6-9,11-18H,4-5,10,19H2,1-3H3,(H,34,35,36,37) |
| InChIKey | JQFDTCICWTXXPF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|