C30H28N8O2 — CID 23216593
[2-butyl-6-(1-oxidopyridin-1-ium-2-yl)-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]methanol (PubChem CID 23216593) has the molecular formula C30H28N8O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is [2-butyl-6-(1-oxidopyridin-1-ium-2-yl)-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]methanol.
| Compound Name | [2-butyl-6-(1-oxidopyridin-1-ium-2-yl)-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 23216593 |
| Molecular Formula | C30H28N8O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [2-butyl-6-(1-oxidopyridin-1-ium-2-yl)-3-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methyl]imidazo[4,5-b]pyridin-5-yl]methanol |
| SMILES | CCCCc1nc2cc(-c3cccc[n+]3[O-])c(CO)nc2n1Cc1ccc(-c2ccccc2)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C30H28N8O2/c1-2-3-12-28-31-25-17-24(27-11-7-8-15-38(27)40)26(19-39)32-30(25)37(28)18-20-13-14-22(21-9-5-4-6-10-21)23(16-20)29-33-35-36-34-29/h4-11,13-17,39H,2-3,12,18-19H2,1H3,(H,33,34,35,36) |
| InChIKey | GXMSKEKYPTZBGD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 132.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|