C31H31N7O2S — CID 22100409
2-butyl-5-(dimethoxymethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-thiophen-2-ylimidazo[4,5-b]pyridine (PubChem CID 22100409) has the molecular formula C31H31N7O2S and a molecular weight of 565.70 g/mol. Its IUPAC name is 2-butyl-5-(dimethoxymethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-thiophen-2-ylimidazo[4,5-b]pyridine.
| Compound Name | 2-butyl-5-(dimethoxymethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-thiophen-2-ylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 22100409 |
| Molecular Formula | C31H31N7O2S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 2-butyl-5-(dimethoxymethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-thiophen-2-ylimidazo[4,5-b]pyridine |
| SMILES | CCCCc1nc2cc(-c3cccs3)c(C(OC)OC)nc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H31N7O2S/c1-4-5-12-27-32-25-18-24(26-11-8-17-41-26)28(31(39-2)40-3)33-30(25)38(27)19-20-13-15-21(16-14-20)22-9-6-7-10-23(22)29-34-36-37-35-29/h6-11,13-18,31H,4-5,12,19H2,1-3H3,(H,34,35,36,37) |
| InChIKey | ISUYLOXPMYXOGY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|