C34H36N8O2 — CID 22100352
2-butyl-5-(diethoxymethyl)-6-pyridin-4-yl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine (PubChem CID 22100352) has the molecular formula C34H36N8O2 and a molecular weight of 588.72 g/mol. Its IUPAC name is 2-butyl-5-(diethoxymethyl)-6-pyridin-4-yl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-butyl-5-(diethoxymethyl)-6-pyridin-4-yl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 22100352 |
| Molecular Formula | C34H36N8O2 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 2-butyl-5-(diethoxymethyl)-6-pyridin-4-yl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCCCc1nc2cc(-c3ccncc3)c(C(OCC)OCC)nc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C34H36N8O2/c1-4-7-12-30-36-29-21-28(25-17-19-35-20-18-25)31(34(43-5-2)44-6-3)37-33(29)42(30)22-23-13-15-24(16-14-23)26-10-8-9-11-27(26)32-38-40-41-39-32/h8-11,13-21,34H,4-7,12,22H2,1-3H3,(H,38,39,40,41) |
| InChIKey | PHDVVZYEJHHDIX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|