C33H32N8O4 — CID 51030762
2-butyl-5-(dimethoxymethyl)-6-(2-nitrophenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine (PubChem CID 51030762) has the molecular formula C33H32N8O4 and a molecular weight of 604.67 g/mol. Its IUPAC name is 2-butyl-5-(dimethoxymethyl)-6-(2-nitrophenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-butyl-5-(dimethoxymethyl)-6-(2-nitrophenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 51030762 |
| Molecular Formula | C33H32N8O4 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 2-butyl-5-(dimethoxymethyl)-6-(2-nitrophenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCCCc1nc2cc(-c3ccccc3[N+](=O)[O-])c(C(OC)OC)nc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H32N8O4/c1-4-5-14-29-34-27-19-26(24-11-8-9-13-28(24)41(42)43)30(33(44-2)45-3)35-32(27)40(29)20-21-15-17-22(18-16-21)23-10-6-7-12-25(23)31-36-38-39-37-31/h6-13,15-19,33H,4-5,14,20H2,1-3H3,(H,36,37,38,39) |
| InChIKey | XVSAKDACWGEXLI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|