C32H35ClN8O2 — CID 22914872
[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(diethylaminomethyl)-1-oxidopyridin-1-ium-2-yl]methanone (PubChem CID 22914872) has the molecular formula C32H35ClN8O2 and a molecular weight of 599.14 g/mol. Its IUPAC name is [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(diethylaminomethyl)-1-oxidopyridin-1-ium-2-yl]methanone.
| Compound Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(diethylaminomethyl)-1-oxidopyridin-1-ium-2-yl]methanone |
|---|---|
| PubChem CID | 22914872 |
| Molecular Formula | C32H35ClN8O2 |
| Molecular Weight | 599.14 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | [2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-[5-(diethylaminomethyl)-1-oxidopyridin-1-ium-2-yl]methanone |
| SMILES | CCCCc1nc(Cl)c(C(=O)c2ccc(CN(CC)CC)c[n+]2[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H35ClN8O2/c1-4-7-12-28-34-31(33)29(30(42)27-18-15-23(21-41(27)43)19-39(5-2)6-3)40(28)20-22-13-16-24(17-14-22)25-10-8-9-11-26(25)32-35-37-38-36-32/h8-11,13-18,21H,4-7,12,19-20H2,1-3H3,(H,35,36,37,38) |
| InChIKey | UTKMAZBJHQGKOG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.14 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|