C21H18ClN6O2- — CID 171905204
5-chloro-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 171905204) has the molecular formula C21H18ClN6O2- and a molecular weight of 421.87 g/mol. Its IUPAC name is 5-chloro-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 5-chloro-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 171905204 |
| Molecular Formula | C21H18ClN6O2- |
| Molecular Weight | 421.87 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 5-chloro-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | [CH2-]CCc1nc(Cl)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C21H18ClN6O2/c1-2-5-17-23-19(22)18(21(29)30)28(17)12-13-8-10-14(11-9-13)15-6-3-4-7-16(15)20-24-26-27-25-20/h3-4,6-11H,1-2,5,12H2,(H,29,30)(H,24,25,26,27)/q-1 |
| InChIKey | MQVMOFDZIVEGBB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|