C32H35ClN8O3 — CID 22914887
6-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-hydroxymethyl]-N,N-diethyl-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 22914887) has the molecular formula C32H35ClN8O3 and a molecular weight of 615.14 g/mol. Its IUPAC name is 6-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-hydroxymethyl]-N,N-diethyl-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | 6-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-hydroxymethyl]-N,N-diethyl-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 22914887 |
| Molecular Formula | C32H35ClN8O3 |
| Molecular Weight | 615.14 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 6-[[2-butyl-5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-hydroxymethyl]-N,N-diethyl-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | CCCCc1nc(Cl)c(C(O)c2cccc(C(=O)N(CC)CC)[n+]2[O-])n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H35ClN8O3/c1-4-7-15-27-34-30(33)28(29(42)25-13-10-14-26(41(25)44)32(43)39(5-2)6-3)40(27)20-21-16-18-22(19-17-21)23-11-8-9-12-24(23)31-35-37-38-36-31/h8-14,16-19,29,42H,4-7,15,20H2,1-3H3,(H,35,36,37,38) |
| InChIKey | KFZGFHLDCMINJN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 139.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.14 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|